C18H22N2O4 — CID 90705450
3-hexyl-6-methyl-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 90705450) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-hexyl-6-methyl-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 3-hexyl-6-methyl-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 90705450 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-hexyl-6-methyl-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | CCCCCCn1c(O)c2c(c1O)C2(C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O4/c1-3-4-5-8-11-19-16(21)14-15(17(19)22)18(14,2)12-9-6-7-10-13(12)20(23)24/h6-7,9-10,21-22H,3-5,8,11H2,1-2H3 |
| InChIKey | JKNHPBQJPCYOLJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|