C22H20N2O4 — CID 54497581
2-benzyl-4-methyl-7-(2-nitrophenyl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 54497581) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-benzyl-4-methyl-7-(2-nitrophenyl)-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-benzyl-4-methyl-7-(2-nitrophenyl)-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54497581 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-benzyl-4-methyl-7-(2-nitrophenyl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC1C=CC(c2ccccc2[N+](=O)[O-])c2c1c(O)n(Cc1ccccc1)c2O |
| InChI | InChI=1S/C22H20N2O4/c1-14-11-12-17(16-9-5-6-10-18(16)24(27)28)20-19(14)21(25)23(22(20)26)13-15-7-3-2-4-8-15/h2-12,14,17,25-26H,13H2,1H3 |
| InChIKey | YAFAYUYSCRKZGV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|