C15H13F3N2O4 — CID 91366161
2-[4-nitro-3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 91366161) has the molecular formula C15H13F3N2O4 and a molecular weight of 342.27 g/mol. Its IUPAC name is 2-[4-nitro-3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[4-nitro-3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91366161 |
| Molecular Formula | C15H13F3N2O4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[4-nitro-3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(-n2c(O)c3c(c2O)CCCC3)cc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O4/c16-15(17,18)11-7-8(5-6-12(11)20(23)24)19-13(21)9-3-1-2-4-10(9)14(19)22/h5-7,21-22H,1-4H2 |
| InChIKey | KOEWLUYVNYTYQJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|