C19H13FN2O4 — CID 91423675
4-(3-fluoro-4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 91423675) has the molecular formula C19H13FN2O4 and a molecular weight of 352.32 g/mol. Its IUPAC name is 4-(3-fluoro-4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | 4-(3-fluoro-4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91423675 |
| Molecular Formula | C19H13FN2O4 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-(3-fluoro-4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | O=[N+]([O-])c1c(F)cc(-n2c(O)c3c(c2O)C2C=CC3C2)c2ccccc12 |
| InChI | InChI=1S/C19H13FN2O4/c20-13-8-14(11-3-1-2-4-12(11)17(13)22(25)26)21-18(23)15-9-5-6-10(7-9)16(15)19(21)24/h1-6,8-10,23-24H,7H2 |
| InChIKey | XHKICVUHVNLNKF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|