C16H13F3N2O4 — CID 91102949
(1R,7S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (PubChem CID 91102949) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is (1R,7S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
| Compound Name | (1R,7S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 91102949 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (1R,7S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
| SMILES | O=[N+]([O-])c1ccc(-n2c(O)c3c(c2O)[C@H]2CC[C@@H]3C2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O4/c17-16(18,19)10-6-9(3-4-11(10)21(24)25)20-14(22)12-7-1-2-8(5-7)13(12)15(20)23/h3-4,6-8,22-23H,1-2,5H2/t7-,8+ |
| InChIKey | DVCCDJPGAPRKGE-OCAPTIKFSA-N |
| XLogP | 4.18 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|