C17H14F3NO2 — CID 90856034
(1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol (PubChem CID 90856034) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is (1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol.
| Compound Name | (1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90856034 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1cccc(C(F)(F)F)c1)[C@@H]1C[C@H]2[C@H]2C[C@H]21 |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)7-2-1-3-8(4-7)21-15(22)13-11-6-12(10-5-9(10)11)14(13)16(21)23/h1-4,9-12,22-23H,5-6H2/t9-,10+,11-,12+ |
| InChIKey | MJXNCNSSUNHKIS-BKUVIOGVSA-N |
| XLogP | 4.13 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |