C17H13F3N2O4 — CID 90911978
(1S,7R,8R,10S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol (PubChem CID 90911978) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is (1S,7R,8R,10S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol.
| Compound Name | (1S,7R,8R,10S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90911978 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (1S,7R,8R,10S)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol |
| SMILES | O=[N+]([O-])c1ccc(-n2c(O)c3c(c2O)[C@@H]2C[C@H]3[C@H]3C[C@H]32)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13F3N2O4/c18-17(19,20)11-3-6(1-2-12(11)22(25)26)21-15(23)13-9-5-10(8-4-7(8)9)14(13)16(21)24/h1-3,7-10,23-24H,4-5H2/t7-,8+,9-,10+ |
| InChIKey | DUOWHVNBHDQUGH-YNFQOJQRSA-N |
| XLogP | 4.04 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|