C16H13FN2O4 — CID 91573352
(1S,7R)-4-(4-fluoro-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol (PubChem CID 91573352) has the molecular formula C16H13FN2O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is (1S,7R)-4-(4-fluoro-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol.
| Compound Name | (1S,7R)-4-(4-fluoro-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91573352 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (1S,7R)-4-(4-fluoro-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
| SMILES | O=[N+]([O-])c1cc(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3CC2)ccc1F |
| InChI | InChI=1S/C16H13FN2O4/c17-11-6-5-10(7-12(11)19(22)23)18-15(20)13-8-1-2-9(4-3-8)14(13)16(18)21/h1-2,5-9,20-21H,3-4H2/t8-,9+ |
| InChIKey | DBGXPGRHXBALBG-DTORHVGOSA-N |
| XLogP | 3.47 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|