C9H9BrCl2O2 — CID 54569762
2-(bromomethyl)-1,3-dichloro-4-(methylperoxymethyl)benzene (PubChem CID 54569762) has the molecular formula C9H9BrCl2O2 and a molecular weight of 299.98 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-dichloro-4-(methylperoxymethyl)benzene.
| Compound Name | 2-(bromomethyl)-1,3-dichloro-4-(methylperoxymethyl)benzene |
|---|---|
| PubChem CID | 54569762 |
| Molecular Formula | C9H9BrCl2O2 |
| Molecular Weight | 299.98 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 2-(bromomethyl)-1,3-dichloro-4-(methylperoxymethyl)benzene |
| SMILES | COOCc1ccc(Cl)c(CBr)c1Cl |
| InChI | InChI=1S/C9H9BrCl2O2/c1-13-14-5-6-2-3-8(11)7(4-10)9(6)12/h2-3H,4-5H2,1H3 |
| InChIKey | ZWKKHTLSQHSLIC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|