C30H51NO — CID 54573655
(1S,4aR,4bS)-N-decyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide (PubChem CID 54573655) has the molecular formula C30H51NO and a molecular weight of 441.74 g/mol. Its IUPAC name is (1S,4aR,4bS)-N-decyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aR,4bS)-N-decyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 54573655 |
| Molecular Formula | C30H51NO |
| Molecular Weight | 441.74 g/mol |
| Exact Mass | 441.40 |
| IUPAC Name | (1S,4aR,4bS)-N-decyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide |
| SMILES | CCCCCCCCCCNC(=O)[C@@]1(C)CCC[C@@]2(C)C1CC=C1C=C(C(C)C)CC[C@H]12 |
| InChI | InChI=1S/C30H51NO/c1-6-7-8-9-10-11-12-13-21-31-28(32)30(5)20-14-19-29(4)26-17-15-24(23(2)3)22-25(26)16-18-27(29)30/h16,22-23,26-27H,6-15,17-21H2,1-5H3,(H,31,32)/t26-,27?,29-,30+/m1/s1 |
| InChIKey | ZZBJCRCKMUSICZ-LSFPQIFWSA-N |
| XLogP | 8.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.74 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|