C16H14N2O6S2 — CID 54576092
(2S)-2-[[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoyl]amino]pentanedioic acid (PubChem CID 54576092) has the molecular formula C16H14N2O6S2 and a molecular weight of 394.43 g/mol. Its IUPAC name is (2S)-2-[[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 54576092 |
| Molecular Formula | C16H14N2O6S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (2S)-2-[[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc(/C=C2\SC(=S)NC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C16H14N2O6S2/c19-12(20)6-5-10(15(23)24)17-13(21)9-3-1-8(2-4-9)7-11-14(22)18-16(25)26-11/h1-4,7,10H,5-6H2,(H,17,21)(H,19,20)(H,23,24)(H,18,22,25)/b11-7-/t10-/m0/s1 |
| InChIKey | WTDHGQVHFUZGJX-QBQSQJOESA-N |
| XLogP | 1.22 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|