C29H45N3O7 — CID 54577421
tert-butyl (3R,4R)-3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-prop-2-enoxypyrrolidine-1-carboxylate (PubChem CID 54577421) has the molecular formula C29H45N3O7 and a molecular weight of 547.69 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-prop-2-enoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-prop-2-enoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54577421 |
| Molecular Formula | C29H45N3O7 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | tert-butyl (3R,4R)-3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-prop-2-enoxypyrrolidine-1-carboxylate |
| SMILES | C=CCO[C@H]1CN(C(=O)OC(C)(C)C)C[C@H]1Cc1cc(C)cc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C29H45N3O7/c1-12-13-36-22-18-31(24(33)37-27(3,4)5)17-20(22)16-21-14-19(2)15-23(30-21)32(25(34)38-28(6,7)8)26(35)39-29(9,10)11/h12,14-15,20,22H,1,13,16-18H2,2-11H3/t20-,22+/m1/s1 |
| InChIKey | IOYHHPWZYBGMRM-IRLDBZIGSA-N |
| XLogP | 6.05 |
| TPSA | 107.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|