C24H37N3O6 — CID 89027318
tert-butyl (3R,4R)-3-[[4-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]methyl]-4-(3-oxopropoxy)pyrrolidine-1-carboxylate (PubChem CID 89027318) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[[4-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]methyl]-4-(3-oxopropoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[[4-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]methyl]-4-(3-oxopropoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89027318 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | tert-butyl (3R,4R)-3-[[4-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]methyl]-4-(3-oxopropoxy)pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C[C@@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2OCCC=O)nc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H37N3O6/c1-16-11-18(25-20(12-16)26-21(29)32-23(2,3)4)13-17-14-27(22(30)33-24(5,6)7)15-19(17)31-10-8-9-28/h9,11-12,17,19H,8,10,13-15H2,1-7H3,(H,25,26,29)/t17-,19+/m1/s1 |
| InChIKey | SJYZEDNMKLJZDX-MJGOQNOKSA-N |
| XLogP | 4.12 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|