C28H40N2O3 — CID 70847628
tert-butyl (3R,4R)-3-[(4,6-dimethyl-2-pyridinyl)methyl]-4-(5-phenylpentoxy)pyrrolidine-1-carboxylate (PubChem CID 70847628) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[(4,6-dimethyl-2-pyridinyl)methyl]-4-(5-phenylpentoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[(4,6-dimethyl-2-pyridinyl)methyl]-4-(5-phenylpentoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70847628 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | tert-butyl (3R,4R)-3-[(4,6-dimethyl-2-pyridinyl)methyl]-4-(5-phenylpentoxy)pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C)nc(C[C@@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2OCCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C28H40N2O3/c1-21-16-22(2)29-25(17-21)18-24-19-30(27(31)33-28(3,4)5)20-26(24)32-15-11-7-10-14-23-12-8-6-9-13-23/h6,8-9,12-13,16-17,24,26H,7,10-11,14-15,18-20H2,1-5H3/t24-,26+/m1/s1 |
| InChIKey | BZNMZNSCGNCOLN-RSXGOPAZSA-N |
| XLogP | 5.91 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|