C36H53ClN4O7 — CID 66624685
tert-butyl 3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-[2-[(1-chloro-2-phenylethyl)amino]ethoxy]pyrrolidine-1-carboxylate (PubChem CID 66624685) has the molecular formula C36H53ClN4O7 and a molecular weight of 689.29 g/mol. Its IUPAC name is tert-butyl 3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-[2-[(1-chloro-2-phenylethyl)amino]ethoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-[2-[(1-chloro-2-phenylethyl)amino]ethoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66624685 |
| Molecular Formula | C36H53ClN4O7 |
| Molecular Weight | 689.29 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | tert-butyl 3-[[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-2-pyridinyl]methyl]-4-[2-[(1-chloro-2-phenylethyl)amino]ethoxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(CC2CN(C(=O)OC(C)(C)C)CC2OCCNC(Cl)Cc2ccccc2)nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C36H53ClN4O7/c1-24-18-27(39-30(19-24)41(32(43)47-35(5,6)7)33(44)48-36(8,9)10)21-26-22-40(31(42)46-34(2,3)4)23-28(26)45-17-16-38-29(37)20-25-14-12-11-13-15-25/h11-15,18-19,26,28-29,38H,16-17,20-23H2,1-10H3 |
| InChIKey | QNMWSKZKCDGLNS-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.29 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|