C39H53NO5 — CID 54584041
1-O-benzyl 10-O-[(1S,9R,10S)-17-(cyclobutylmethyl)-10-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate (PubChem CID 54584041) has the molecular formula C39H53NO5 and a molecular weight of 615.86 g/mol. Its IUPAC name is 1-O-benzyl 10-O-[(1S,9R,10S)-17-(cyclobutylmethyl)-10-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate.
| Compound Name | 1-O-benzyl 10-O-[(1S,9R,10S)-17-(cyclobutylmethyl)-10-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate |
|---|---|
| PubChem CID | 54584041 |
| Molecular Formula | C39H53NO5 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.39 |
| IUPAC Name | 1-O-benzyl 10-O-[(1S,9R,10S)-17-(cyclobutylmethyl)-10-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate |
| SMILES | CO[C@@]12CCCC[C@@]13CCN(CC1CCC1)[C@@H]2Cc1ccc(OC(=O)CCCCCCCCC(=O)OCc2ccccc2)cc13 |
| InChI | InChI=1S/C39H53NO5/c1-43-39-23-12-11-22-38(39)24-25-40(28-30-16-13-17-30)35(39)26-32-20-21-33(27-34(32)38)45-37(42)19-10-5-3-2-4-9-18-36(41)44-29-31-14-7-6-8-15-31/h6-8,14-15,20-21,27,30,35H,2-5,9-13,16-19,22-26,28-29H2,1H3/t35-,38+,39-/m1/s1 |
| InChIKey | OVPROZAAWKHKOP-GFMHJGOASA-N |
| XLogP | 8.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|