C13H25Cl2N3O2 — CID 54587423
5-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pentyl-trimethylazanium chloride (PubChem CID 54587423) has the molecular formula C13H25Cl2N3O2 and a molecular weight of 326.27 g/mol. Its IUPAC name is 5-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pentyl-trimethylazanium chloride.
| Compound Name | 5-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pentyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 54587423 |
| Molecular Formula | C13H25Cl2N3O2 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 5-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pentyl-trimethylazanium chloride |
| SMILES | CC1(C)C(=O)N(CCCCC[N+](C)(C)C)C(=O)N1Cl.[Cl-] |
| InChI | InChI=1S/C13H25ClN3O2.ClH/c1-13(2)11(18)15(12(19)16(13)14)9-7-6-8-10-17(3,4)5;/h6-10H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GLUXQXFYRUFCEE-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|