C27H38Cl4N4O8P2 — CID 54588718
4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[2-(4-nitrophenyl)ethoxy]phosphoryl]methyl]-[2-(4-nitrophenyl)ethoxy]phosphoryl]-N-methylbutan-1-amine (PubChem CID 54588718) has the molecular formula C27H38Cl4N4O8P2 and a molecular weight of 750.38 g/mol. Its IUPAC name is 4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[2-(4-nitrophenyl)ethoxy]phosphoryl]methyl]-[2-(4-nitrophenyl)ethoxy]phosphoryl]-N-methylbutan-1-amine.
| Compound Name | 4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[2-(4-nitrophenyl)ethoxy]phosphoryl]methyl]-[2-(4-nitrophenyl)ethoxy]phosphoryl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 54588718 |
| Molecular Formula | C27H38Cl4N4O8P2 |
| Molecular Weight | 750.38 g/mol |
| Exact Mass | 748.09 |
| IUPAC Name | 4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[2-(4-nitrophenyl)ethoxy]phosphoryl]methyl]-[2-(4-nitrophenyl)ethoxy]phosphoryl]-N-methylbutan-1-amine |
| SMILES | CN(CCCCCl)P(=O)(OCCc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)P(=O)(OCCc1ccc([N+](=O)[O-])cc1)N(C)CCCCCl |
| InChI | InChI=1S/C27H38Cl4N4O8P2/c1-32(19-5-3-17-28)44(40,42-21-15-23-7-11-25(12-8-23)34(36)37)27(30,31)45(41,33(2)20-6-4-18-29)43-22-16-24-9-13-26(14-10-24)35(38)39/h7-14H,3-6,15-22H2,1-2H3 |
| InChIKey | AEPLJTGCIAUHOE-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.38 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|