C25H34Cl4N4O8P2 — CID 54587972
4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[(4-nitrophenyl)methoxy]phosphoryl]methyl]-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylbutan-1-amine (PubChem CID 54587972) has the molecular formula C25H34Cl4N4O8P2 and a molecular weight of 722.33 g/mol. Its IUPAC name is 4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[(4-nitrophenyl)methoxy]phosphoryl]methyl]-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylbutan-1-amine.
| Compound Name | 4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[(4-nitrophenyl)methoxy]phosphoryl]methyl]-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 54587972 |
| Molecular Formula | C25H34Cl4N4O8P2 |
| Molecular Weight | 722.33 g/mol |
| Exact Mass | 720.06 |
| IUPAC Name | 4-chloro-N-[[dichloro-[[4-chlorobutyl(methyl)amino]-[(4-nitrophenyl)methoxy]phosphoryl]methyl]-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylbutan-1-amine |
| SMILES | CN(CCCCCl)P(=O)(OCc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)P(=O)(OCc1ccc([N+](=O)[O-])cc1)N(C)CCCCCl |
| InChI | InChI=1S/C25H34Cl4N4O8P2/c1-30(17-5-3-15-26)42(38,40-19-21-7-11-23(12-8-21)32(34)35)25(28,29)43(39,31(2)18-6-4-16-27)41-20-22-9-13-24(14-10-22)33(36)37/h7-14H,3-6,15-20H2,1-2H3 |
| InChIKey | ROKARLAVHOSXAJ-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.33 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|