C23H34N4O8P2 — CID 88888642
N-[[diethylamino-[(4-nitrophenyl)methoxy]phosphoryl]methyl-[(4-nitrophenyl)methoxy]phosphoryl]-N-ethylethanamine (PubChem CID 88888642) has the molecular formula C23H34N4O8P2 and a molecular weight of 556.49 g/mol. Its IUPAC name is N-[[diethylamino-[(4-nitrophenyl)methoxy]phosphoryl]methyl-[(4-nitrophenyl)methoxy]phosphoryl]-N-ethylethanamine.
| Compound Name | N-[[diethylamino-[(4-nitrophenyl)methoxy]phosphoryl]methyl-[(4-nitrophenyl)methoxy]phosphoryl]-N-ethylethanamine |
|---|---|
| PubChem CID | 88888642 |
| Molecular Formula | C23H34N4O8P2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N-[[diethylamino-[(4-nitrophenyl)methoxy]phosphoryl]methyl-[(4-nitrophenyl)methoxy]phosphoryl]-N-ethylethanamine |
| SMILES | CCN(CC)P(=O)(CP(=O)(OCc1ccc([N+](=O)[O-])cc1)N(CC)CC)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H34N4O8P2/c1-5-24(6-2)36(32,34-17-20-9-13-22(14-10-20)26(28)29)19-37(33,25(7-3)8-4)35-18-21-11-15-23(16-12-21)27(30)31/h9-16H,5-8,17-19H2,1-4H3 |
| InChIKey | LZJTZNIOQYRBGT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|