C10H16N3O4P — CID 71137275
N-[amino-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylethanamine (PubChem CID 71137275) has the molecular formula C10H16N3O4P and a molecular weight of 273.23 g/mol. Its IUPAC name is N-[amino-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylethanamine.
| Compound Name | N-[amino-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylethanamine |
|---|---|
| PubChem CID | 71137275 |
| Molecular Formula | C10H16N3O4P |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-[amino-[(4-nitrophenyl)methoxy]phosphoryl]-N-methylethanamine |
| SMILES | CCN(C)P(N)(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H16N3O4P/c1-3-12(2)18(11,16)17-8-9-4-6-10(7-5-9)13(14)15/h4-7H,3,8H2,1-2H3,(H2,11,16) |
| InChIKey | LKJRHOANXLMSNZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|