C28H41F17O4Si2 — CID 54592128
(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyhex-2-enoic acid (PubChem CID 54592128) has the molecular formula C28H41F17O4Si2 and a molecular weight of 820.77 g/mol. Its IUPAC name is (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyhex-2-enoic acid.
| Compound Name | (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyhex-2-enoic acid |
|---|---|
| PubChem CID | 54592128 |
| Molecular Formula | C28H41F17O4Si2 |
| Molecular Weight | 820.77 g/mol |
| Exact Mass | 820.23 |
| IUPAC Name | (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyhex-2-enoic acid |
| SMILES | CC(C)[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(O[C@H](/C=C/C(=O)O)[C@H](C)O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C28H41F17O4Si2/c1-15(2)51(16(3)4,49-18(11-12-19(46)47)17(5)48-50(9,10)20(6,7)8)14-13-21(29,30)22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)45/h11-12,15-18H,13-14H2,1-10H3,(H,46,47)/b12-11+/t17-,18+/m0/s1 |
| InChIKey | IWMKELOGSSWDCA-AAIOHFERSA-N |
| XLogP | 11.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.77 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|