N-(cyclopropylmethyl)-N-methylsulfamoyl chloride

C5H10ClNO2S — CID 54594619

IUPACN-(cyclopropylmethyl)-N-methylsulfamoyl chloride
SMILESCN(CC1CC1)S(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO2S/c1-7(10(6,8)9)4-5-2-3-5/h5H,2-4H2,1H3
InChIKeyGPRTVPRJLPKURR-UHFFFAOYSA-N
MW183.66 g/mol
LogP0.81
Rot. Bonds3

About N-(cyclopropylmethyl)-N-methylsulfamoyl chloride

N-(cyclopropylmethyl)-N-methylsulfamoyl chloride (PubChem CID 54594619) has the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-methylsulfamoyl chloride.

Molecular Properties

Compound NameN-(cyclopropylmethyl)-N-methylsulfamoyl chloride
PubChem CID54594619
Molecular FormulaC5H10ClNO2S
Molecular Weight183.66 g/mol
Exact Mass183.01
IUPAC NameN-(cyclopropylmethyl)-N-methylsulfamoyl chloride
SMILESCN(CC1CC1)S(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO2S/c1-7(10(6,8)9)4-5-2-3-5/h5H,2-4H2,1H3
InChIKeyGPRTVPRJLPKURR-UHFFFAOYSA-N
XLogP0.81
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.66
LogP ≤ 50.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-(cyclopropylmethyl)-N-methylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-butyl-N-methylsulfamoyl chloride
CID 16770019
N-Methyl-N-(2-methylpropyl)sulfamoyl chloride
CID 43272017
N-(cyclopropylmethyl)-N-propylsulfamoyl chloride
CID 16770038
N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride
CID 63955757
[Methyl(sulfamoyl)amino]methylcyclopropane
CID 60985019
[Methyl(sulfinato)amino]methylcyclopropane
CID 58392029
[Propyl(sulfinato)amino]methylcyclopropane
CID 122647028
[Ethyl(sulfinato)amino]methylcyclopropane
CID 134590496
N-ethyl-N-(2-methylpropyl)sulfamoyl chloride
CID 43273594
N-methyl-N-(2-methylbutyl)sulfamoyl chloride
CID 43295660
N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride
CID 43569022
[Methyl(sulfino)amino]methylcyclopropane
CID 58392030

Frequently Asked Questions

What is the IUPAC name of N-(cyclopropylmethyl)-N-methylsulfamoyl chloride?
The IUPAC name of N-(cyclopropylmethyl)-N-methylsulfamoyl chloride (CID 54594619) is N-(cyclopropylmethyl)-N-methylsulfamoyl chloride.
What is the SMILES notation for N-(cyclopropylmethyl)-N-methylsulfamoyl chloride?
The canonical SMILES for N-(cyclopropylmethyl)-N-methylsulfamoyl chloride is CN(CC1CC1)S(=O)(=O)Cl.
What is the InChIKey of N-(cyclopropylmethyl)-N-methylsulfamoyl chloride?
The InChIKey is GPRTVPRJLPKURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO2S/c1-7(10(6,8)9)4-5-2-3-5/h5H,2-4H2,1H3.
What are the key properties of N-(cyclopropylmethyl)-N-methylsulfamoyl chloride?
N-(cyclopropylmethyl)-N-methylsulfamoyl chloride has a molecular weight of 183.66 g/mol, XLogP of 0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N-methylsulfamoyl chloride is sourced from PubChem (CID 54594619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).