C18H11F3N6O3S — CID 54596474
N-(1,2,3-benzothiadiazol-5-yl)-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-nitrobenzamide (PubChem CID 54596474) has the molecular formula C18H11F3N6O3S and a molecular weight of 448.39 g/mol. Its IUPAC name is N-(1,2,3-benzothiadiazol-5-yl)-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-nitrobenzamide.
| Compound Name | N-(1,2,3-benzothiadiazol-5-yl)-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 54596474 |
| Molecular Formula | C18H11F3N6O3S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-(1,2,3-benzothiadiazol-5-yl)-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-nitrobenzamide |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(C(=O)Nc2ccc3snnc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H11F3N6O3S/c1-26-13(8-16(24-26)18(19,20)21)11-4-2-9(6-14(11)27(29)30)17(28)22-10-3-5-15-12(7-10)23-25-31-15/h2-8H,1H3,(H,22,28) |
| InChIKey | NRQKDJFVJUEBBO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|