C24H27ClN8 — CID 54598626
2-methyl-1-[(E)-1-[4-[(E)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]fluoranthen-8-yl]ethylideneamino]guanidine;hydrochloride (PubChem CID 54598626) has the molecular formula C24H27ClN8 and a molecular weight of 462.99 g/mol. Its IUPAC name is 2-methyl-1-[(E)-1-[4-[(E)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]fluoranthen-8-yl]ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-methyl-1-[(E)-1-[4-[(E)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]fluoranthen-8-yl]ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 54598626 |
| Molecular Formula | C24H27ClN8 |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-methyl-1-[(E)-1-[4-[(E)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]fluoranthen-8-yl]ethylideneamino]guanidine;hydrochloride |
| SMILES | C/N=C(\N)N/N=C(\C)c1ccc2c(c1)-c1ccc(/C(C)=N/N/C(N)=N/C)c3cccc-2c13.Cl |
| InChI | InChI=1S/C24H26N8.ClH/c1-13(29-31-23(25)27-3)15-8-9-17-19-7-5-6-18-16(14(2)30-32-24(26)28-4)10-11-20(22(18)19)21(17)12-15;/h5-12H,1-4H3,(H3,25,27,31)(H3,26,28,32);1H/b29-13+,30-14+; |
| InChIKey | HMIKSPWFCYQQSO-VHPMZGPXSA-N |
| XLogP | 3.43 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|