C18H19ClN4 — CID 54611026
2-methyl-1-[(E)-1-phenanthren-3-ylethylideneamino]guanidine;hydrochloride (PubChem CID 54611026) has the molecular formula C18H19ClN4 and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-methyl-1-[(E)-1-phenanthren-3-ylethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-methyl-1-[(E)-1-phenanthren-3-ylethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 54611026 |
| Molecular Formula | C18H19ClN4 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-methyl-1-[(E)-1-phenanthren-3-ylethylideneamino]guanidine;hydrochloride |
| SMILES | C/N=C(\N)N/N=C(\C)c1ccc2ccc3ccccc3c2c1.Cl |
| InChI | InChI=1S/C18H18N4.ClH/c1-12(21-22-18(19)20-2)15-10-9-14-8-7-13-5-3-4-6-16(13)17(14)11-15;/h3-11H,1-2H3,(H3,19,20,22);1H/b21-12+; |
| InChIKey | FASXITWDKRLTFO-BFVDCFMLSA-N |
| XLogP | 3.67 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|