C20H25N8S+ — CID 44576955
[amino-[(2Z)-2-[1-[8-[(Z)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]dibenzothiophen-2-yl]ethylidene]hydrazinyl]methylidene]-methylazanium (PubChem CID 44576955) has the molecular formula C20H25N8S+ and a molecular weight of 409.54 g/mol. Its IUPAC name is [amino-[(2Z)-2-[1-[8-[(Z)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]dibenzothiophen-2-yl]ethylidene]hydrazinyl]methylidene]-methylazanium.
| Compound Name | [amino-[(2Z)-2-[1-[8-[(Z)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]dibenzothiophen-2-yl]ethylidene]hydrazinyl]methylidene]-methylazanium |
|---|---|
| PubChem CID | 44576955 |
| Molecular Formula | C20H25N8S+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [amino-[(2Z)-2-[1-[8-[(Z)-C-methyl-N-[(N'-methylcarbamimidoyl)amino]carbonimidoyl]dibenzothiophen-2-yl]ethylidene]hydrazinyl]methylidene]-methylazanium |
| SMILES | C/N=C(\N)N/N=C(/C)c1ccc2sc3ccc(/C(C)=N\N/C(N)=[NH+]/C)cc3c2c1 |
| InChI | InChI=1S/C20H24N8S/c1-11(25-27-19(21)23-3)13-5-7-17-15(9-13)16-10-14(6-8-18(16)29-17)12(2)26-28-20(22)24-4/h5-10H,1-4H3,(H3,21,23,27)(H3,22,24,28)/p+1/b25-11-,26-12- |
| InChIKey | XCSSSGMWRCNFBK-RSKRUZOQSA-O |
| XLogP | 0.65 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|