C13H28N8 — CID 54599100
2-[(Z)-[(1E)-1-[bis(dimethylamino)methylidenehydrazinylidene]propan-2-ylidene]amino]-1,1,3,3-tetramethylguanidine (PubChem CID 54599100) has the molecular formula C13H28N8 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[(Z)-[(1E)-1-[bis(dimethylamino)methylidenehydrazinylidene]propan-2-ylidene]amino]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[(Z)-[(1E)-1-[bis(dimethylamino)methylidenehydrazinylidene]propan-2-ylidene]amino]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 54599100 |
| Molecular Formula | C13H28N8 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 2-[(Z)-[(1E)-1-[bis(dimethylamino)methylidenehydrazinylidene]propan-2-ylidene]amino]-1,1,3,3-tetramethylguanidine |
| SMILES | CC(/C=N/N=C(N(C)C)N(C)C)=N/N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C13H28N8/c1-11(15-17-13(20(6)7)21(8)9)10-14-16-12(18(2)3)19(4)5/h10H,1-9H3/b14-10+,15-11- |
| InChIKey | FXRXMJBZKRYEFE-AIWUCEOPSA-N |
| XLogP | 0.31 |
| TPSA | 62.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|