C23H30N2O — CID 54610203
5-[(E)-2-(1-ethyl-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-yl)ethenyl]quinolin-8-ol (PubChem CID 54610203) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 5-[(E)-2-(1-ethyl-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-yl)ethenyl]quinolin-8-ol.
| Compound Name | 5-[(E)-2-(1-ethyl-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-yl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 54610203 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 5-[(E)-2-(1-ethyl-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-yl)ethenyl]quinolin-8-ol |
| SMILES | CCN1C(/C=C/c2ccc(O)c3ncccc23)CCC2CC(C)CCC21 |
| InChI | InChI=1S/C23H30N2O/c1-3-25-19(11-8-18-15-16(2)6-12-21(18)25)10-7-17-9-13-22(26)23-20(17)5-4-14-24-23/h4-5,7,9-10,13-14,16,18-19,21,26H,3,6,8,11-12,15H2,1-2H3/b10-7+ |
| InChIKey | RNSCOIXGENJICR-JXMROGBWSA-N |
| XLogP | 5.24 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |