C14H14F2N4O4 — CID 54610925
diethyl (3Z)-2,2-difluoro-3-(7H-purin-6-ylmethylidene)butanedioate (PubChem CID 54610925) has the molecular formula C14H14F2N4O4 and a molecular weight of 340.29 g/mol. Its IUPAC name is diethyl (3Z)-2,2-difluoro-3-(7H-purin-6-ylmethylidene)butanedioate.
| Compound Name | diethyl (3Z)-2,2-difluoro-3-(7H-purin-6-ylmethylidene)butanedioate |
|---|---|
| PubChem CID | 54610925 |
| Molecular Formula | C14H14F2N4O4 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | diethyl (3Z)-2,2-difluoro-3-(7H-purin-6-ylmethylidene)butanedioate |
| SMILES | CCOC(=O)/C(=C/c1ncnc2nc[nH]c12)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C14H14F2N4O4/c1-3-23-12(21)8(14(15,16)13(22)24-4-2)5-9-10-11(19-6-17-9)20-7-18-10/h5-7H,3-4H2,1-2H3,(H,17,18,19,20)/b8-5- |
| InChIKey | OCYPTOQUFMOYAX-YVMONPNESA-N |
| XLogP | 1.50 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|