C22H23NO3 — CID 5461855
methyl (2S,3aR,7S,7aS)-6-oxo-1-[(E)-3-phenylprop-2-enyl]-7-prop-2-ynyl-3,3a,7,7a-tetrahydro-2H-indole-2-carboxylate (PubChem CID 5461855) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (2S,3aR,7S,7aS)-6-oxo-1-[(E)-3-phenylprop-2-enyl]-7-prop-2-ynyl-3,3a,7,7a-tetrahydro-2H-indole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7S,7aS)-6-oxo-1-[(E)-3-phenylprop-2-enyl]-7-prop-2-ynyl-3,3a,7,7a-tetrahydro-2H-indole-2-carboxylate |
|---|---|
| PubChem CID | 5461855 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl (2S,3aR,7S,7aS)-6-oxo-1-[(E)-3-phenylprop-2-enyl]-7-prop-2-ynyl-3,3a,7,7a-tetrahydro-2H-indole-2-carboxylate |
| SMILES | C#CC[C@@H]1C(=O)C=C[C@H]2C[C@@H](C(=O)OC)N(C/C=C/c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C22H23NO3/c1-3-8-18-20(24)13-12-17-15-19(22(25)26-2)23(21(17)18)14-7-11-16-9-5-4-6-10-16/h1,4-7,9-13,17-19,21H,8,14-15H2,2H3/b11-7+/t17-,18+,19-,21-/m0/s1 |
| InChIKey | JBWFADGTVJXTOW-DQKVDQNHSA-N |
| XLogP | 2.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|