C19H25NO6 — CID 11949149
methyl (2S,3aS,4R,5R,6R,7aR)-3a,4,5,6-tetrahydroxy-1-[(E)-3-phenylprop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate (PubChem CID 11949149) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl (2S,3aS,4R,5R,6R,7aR)-3a,4,5,6-tetrahydroxy-1-[(E)-3-phenylprop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate.
| Compound Name | methyl (2S,3aS,4R,5R,6R,7aR)-3a,4,5,6-tetrahydroxy-1-[(E)-3-phenylprop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate |
|---|---|
| PubChem CID | 11949149 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | methyl (2S,3aS,4R,5R,6R,7aR)-3a,4,5,6-tetrahydroxy-1-[(E)-3-phenylprop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(O)[C@H](O)[C@H](O)[C@H](O)C[C@H]2N1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H25NO6/c1-26-18(24)13-11-19(25)15(10-14(21)16(22)17(19)23)20(13)9-5-8-12-6-3-2-4-7-12/h2-8,13-17,21-23,25H,9-11H2,1H3/b8-5+/t13-,14+,15+,16+,17+,19-/m0/s1 |
| InChIKey | PDJWGZRITICYHT-GCKUYJCFSA-N |
| XLogP | -0.47 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |