C10H17NO5 — CID 5465581
(NZ)-N-(4-methoxy-2,2,6-trimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ylidene)hydroxylamine (PubChem CID 5465581) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (NZ)-N-(4-methoxy-2,2,6-trimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(4-methoxy-2,2,6-trimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5465581 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (NZ)-N-(4-methoxy-2,2,6-trimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ylidene)hydroxylamine |
| SMILES | COC1OC(C)/C(=N/O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H17NO5/c1-5-6(11-12)7-8(9(13-4)14-5)16-10(2,3)15-7/h5,7-9,12H,1-4H3/b11-6- |
| InChIKey | PJOWXLWKPHORPK-WDZFZDKYSA-N |
| XLogP | 0.73 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|