C9H13NO4 — CID 101211718
(NZ)-N-[(3aR,5R,6aR)-5-ethenyl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]hydroxylamine (PubChem CID 101211718) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (NZ)-N-[(3aR,5R,6aR)-5-ethenyl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3aR,5R,6aR)-5-ethenyl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 101211718 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (NZ)-N-[(3aR,5R,6aR)-5-ethenyl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]hydroxylamine |
| SMILES | C=C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2/C1=N\O |
| InChI | InChI=1S/C9H13NO4/c1-4-5-6(10-11)7-8(12-5)14-9(2,3)13-7/h4-5,7-8,11H,1H2,2-3H3/b10-6-/t5-,7-,8-/m1/s1 |
| InChIKey | LMXPNNKPCAIQRN-PSCKSQFNSA-N |
| XLogP | 0.88 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|