C23H25N5OS — CID 5467076
N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide (PubChem CID 5467076) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 5467076 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide |
| SMILES | CCCCn1c(-c2ccccc2)cs/c1=N/NC(=O)Cn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C23H25N5OS/c1-3-4-14-27-21(18-10-6-5-7-11-18)16-30-23(27)26-25-22(29)15-28-17(2)24-19-12-8-9-13-20(19)28/h5-13,16H,3-4,14-15H2,1-2H3,(H,25,29)/b26-23+ |
| InChIKey | XSKJBIRMCMRJLJ-WNAAXNPUSA-N |
| XLogP | 4.31 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|