C22H23N5OS — CID 10069862
N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 10069862) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10069862 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[(E)-(3-butyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCCn1c(-c2ccccc2)cs/c1=N/NC(=O)c1c(C)nc2ccccn12 |
| InChI | InChI=1S/C22H23N5OS/c1-3-4-13-26-18(17-10-6-5-7-11-17)15-29-22(26)25-24-21(28)20-16(2)23-19-12-8-9-14-27(19)20/h5-12,14-15H,3-4,13H2,1-2H3,(H,24,28)/b25-22+ |
| InChIKey | JZJPEUBDLWIITQ-YYDJUVGSSA-N |
| XLogP | 4.22 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|