C15H20N4OS — CID 15496669
[(Z)-[3-butyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]urea (PubChem CID 15496669) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is [(Z)-[3-butyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]urea.
| Compound Name | [(Z)-[3-butyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 15496669 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [(Z)-[3-butyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]urea |
| SMILES | CCCCn1c(-c2ccc(C)cc2)cs/c1=N\NC(N)=O |
| InChI | InChI=1S/C15H20N4OS/c1-3-4-9-19-13(12-7-5-11(2)6-8-12)10-21-15(19)18-17-14(16)20/h5-8,10H,3-4,9H2,1-2H3,(H3,16,17,20)/b18-15- |
| InChIKey | FHLVYHJKWOREMM-SDXDJHTJSA-N |
| XLogP | 2.81 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|