C36H44F5NO3S — CID 54671345
4-[(E)-1-[4-[2-[7-(4,4,5,5,5-pentafluoropentylsulfinyl)heptylamino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 54671345) has the molecular formula C36H44F5NO3S and a molecular weight of 665.81 g/mol. Its IUPAC name is 4-[(E)-1-[4-[2-[7-(4,4,5,5,5-pentafluoropentylsulfinyl)heptylamino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[(E)-1-[4-[2-[7-(4,4,5,5,5-pentafluoropentylsulfinyl)heptylamino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 54671345 |
| Molecular Formula | C36H44F5NO3S |
| Molecular Weight | 665.81 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | 4-[(E)-1-[4-[2-[7-(4,4,5,5,5-pentafluoropentylsulfinyl)heptylamino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC/C(=C(/c1ccc(O)cc1)c1ccc(OCCNCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H44F5NO3S/c1-2-33(28-12-7-6-8-13-28)34(29-14-18-31(43)19-15-29)30-16-20-32(21-17-30)45-25-24-42-23-9-4-3-5-10-26-46(44)27-11-22-35(37,38)36(39,40)41/h6-8,12-21,42-43H,2-5,9-11,22-27H2,1H3/b34-33+ |
| InChIKey | GBYGJVWKNMPVJZ-JEIPZWNWSA-N |
| XLogP | 9.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.81 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|