C32H36F5NO3S — CID 18976492
4-[(E)-1-[4-[2-[methyl-[2-(4,4,5,5,5-pentafluoropentylsulfinyl)ethyl]amino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 18976492) has the molecular formula C32H36F5NO3S and a molecular weight of 609.70 g/mol. Its IUPAC name is 4-[(E)-1-[4-[2-[methyl-[2-(4,4,5,5,5-pentafluoropentylsulfinyl)ethyl]amino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[(E)-1-[4-[2-[methyl-[2-(4,4,5,5,5-pentafluoropentylsulfinyl)ethyl]amino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 18976492 |
| Molecular Formula | C32H36F5NO3S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 4-[(E)-1-[4-[2-[methyl-[2-(4,4,5,5,5-pentafluoropentylsulfinyl)ethyl]amino]ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC/C(=C(/c1ccc(O)cc1)c1ccc(OCCN(C)CCS(=O)CCCC(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H36F5NO3S/c1-3-29(24-8-5-4-6-9-24)30(25-10-14-27(39)15-11-25)26-12-16-28(17-13-26)41-21-19-38(2)20-23-42(40)22-7-18-31(33,34)32(35,36)37/h4-6,8-17,39H,3,7,18-23H2,1-2H3/b30-29+ |
| InChIKey | GAWSXOYOPOZMDC-QVIHXGFCSA-N |
| XLogP | 7.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|