C44H62F5NO2SSi — CID 123891268
6-(4,4,5,5,5-pentafluoropentylsulfanyl)-N-[2-[4-[2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]but-1-enyl]phenoxy]ethyl]hexan-1-amine (PubChem CID 123891268) has the molecular formula C44H62F5NO2SSi and a molecular weight of 792.13 g/mol. Its IUPAC name is 6-(4,4,5,5,5-pentafluoropentylsulfanyl)-N-[2-[4-[2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]but-1-enyl]phenoxy]ethyl]hexan-1-amine.
| Compound Name | 6-(4,4,5,5,5-pentafluoropentylsulfanyl)-N-[2-[4-[2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]but-1-enyl]phenoxy]ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 123891268 |
| Molecular Formula | C44H62F5NO2SSi |
| Molecular Weight | 792.13 g/mol |
| Exact Mass | 791.42 |
| IUPAC Name | 6-(4,4,5,5,5-pentafluoropentylsulfanyl)-N-[2-[4-[2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]but-1-enyl]phenoxy]ethyl]hexan-1-amine |
| SMILES | CCC(=C(c1ccc(OCCNCCCCCCSCCCC(F)(F)C(F)(F)F)cc1)c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H62F5NO2SSi/c1-8-41(36-17-12-11-13-18-36)42(38-21-25-40(26-22-38)52-54(33(2)3,34(4)5)35(6)7)37-19-23-39(24-20-37)51-30-29-50-28-14-9-10-15-31-53-32-16-27-43(45,46)44(47,48)49/h11-13,17-26,33-35,50H,8-10,14-16,27-32H2,1-7H3 |
| InChIKey | FHZHHPGKMPCBIB-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.13 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|