C31H37NO3S — CID 69328900
2-[6-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]hexylsulfanyl]-N-methylacetamide (PubChem CID 69328900) has the molecular formula C31H37NO3S and a molecular weight of 503.71 g/mol. Its IUPAC name is 2-[6-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]hexylsulfanyl]-N-methylacetamide.
| Compound Name | 2-[6-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]hexylsulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 69328900 |
| Molecular Formula | C31H37NO3S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 2-[6-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]hexylsulfanyl]-N-methylacetamide |
| SMILES | CC/C(=C(/c1ccc(O)cc1)c1ccc(OCCCCCCSCC(=O)NC)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H37NO3S/c1-3-29(24-11-7-6-8-12-24)31(25-13-17-27(33)18-14-25)26-15-19-28(20-16-26)35-21-9-4-5-10-22-36-23-30(34)32-2/h6-8,11-20,33H,3-5,9-10,21-23H2,1-2H3,(H,32,34)/b31-29+ |
| InChIKey | DNFKXYWMNQDTBR-OWWNRXNESA-N |
| XLogP | 7.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|