C15H16N2O6S — CID 54676132
methyl (Z)-2-cyano-3-[2-[(2-ethoxy-2-oxoacetyl)amino]-4,5-dimethylthiophen-3-yl]-3-hydroxyprop-2-enoate (PubChem CID 54676132) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is methyl (Z)-2-cyano-3-[2-[(2-ethoxy-2-oxoacetyl)amino]-4,5-dimethylthiophen-3-yl]-3-hydroxyprop-2-enoate.
| Compound Name | methyl (Z)-2-cyano-3-[2-[(2-ethoxy-2-oxoacetyl)amino]-4,5-dimethylthiophen-3-yl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 54676132 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | methyl (Z)-2-cyano-3-[2-[(2-ethoxy-2-oxoacetyl)amino]-4,5-dimethylthiophen-3-yl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(=O)Nc1sc(C)c(C)c1/C(O)=C(\C#N)C(=O)OC |
| InChI | InChI=1S/C15H16N2O6S/c1-5-23-15(21)12(19)17-13-10(7(2)8(3)24-13)11(18)9(6-16)14(20)22-4/h18H,5H2,1-4H3,(H,17,19)/b11-9- |
| InChIKey | IFUZANGYNKLQGZ-LUAWRHEFSA-N |
| XLogP | 1.83 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|