About iodopalladium(1+);phenol;2-pyridin-2-ylpyridine
iodopalladium(1+);phenol;2-pyridin-2-ylpyridine (PubChem CID 54678898) has the molecular formula C16H13IN2OPd
and a molecular weight of 482.62 g/mol. Its IUPAC name is iodopalladium(1+);phenol;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | iodopalladium(1+);phenol;2-pyridin-2-ylpyridine |
| PubChem CID | 54678898 |
| Molecular Formula | C16H13IN2OPd |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 481.91 |
| IUPAC Name | iodopalladium(1+);phenol;2-pyridin-2-ylpyridine |
| SMILES | Oc1[c-]cccc1.[Pd+]I.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C6H5O.HI.Pd/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;7-6-4-2-1-3-5-6;;/h1-8H;1-4,7H;1H;/q;-1;;+2/p-1 |
| InChIKey | FVZCWGKPNNNQAM-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodopalladium(1+);phenol;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodopalladium(1+);phenol;2-pyridin-2-ylpyridine?
The IUPAC name of iodopalladium(1+);phenol;2-pyridin-2-ylpyridine (CID 54678898) is iodopalladium(1+);phenol;2-pyridin-2-ylpyridine.
What is the SMILES notation for iodopalladium(1+);phenol;2-pyridin-2-ylpyridine?
The canonical SMILES for iodopalladium(1+);phenol;2-pyridin-2-ylpyridine is Oc1[c-]cccc1.[Pd+]I.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of iodopalladium(1+);phenol;2-pyridin-2-ylpyridine?
The InChIKey is FVZCWGKPNNNQAM-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8N2.C6H5O.HI.Pd/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;7-6-4-2-1-3-5-6;;/h1-8H;1-4,7H;1H;/q;-1;;+2/p-1.
What are the key properties of iodopalladium(1+);phenol;2-pyridin-2-ylpyridine?
iodopalladium(1+);phenol;2-pyridin-2-ylpyridine has a molecular weight of 482.62 g/mol, XLogP of 4.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodopalladium(1+);phenol;2-pyridin-2-ylpyridine is sourced from PubChem (CID 54678898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).