C25H27NO5S2 — CID 54688975
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-2-sulfonamide (PubChem CID 54688975) has the molecular formula C25H27NO5S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54688975 |
| Molecular Formula | C25H27NO5S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3cccs3)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C25H27NO5S2/c27-24-19-9-3-1-2-4-10-20(19)31-25(28)23(24)22(16-12-13-16)17-7-5-8-18(15-17)26-33(29,30)21-11-6-14-32-21/h5-8,11,14-16,22,26-27H,1-4,9-10,12-13H2 |
| InChIKey | FJSWTENRGJRAHQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |