C24H26KN7O5S — CID 54698683
potassium 2-[N-ethyl-2-[(Z)-1-hydroxy-3-oxo-3-(propylamino)prop-1-enyl]-4-[[4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoyl]amino]anilino]acetate (PubChem CID 54698683) has the molecular formula C24H26KN7O5S and a molecular weight of 563.68 g/mol. Its IUPAC name is potassium 2-[N-ethyl-2-[(Z)-1-hydroxy-3-oxo-3-(propylamino)prop-1-enyl]-4-[[4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoyl]amino]anilino]acetate.
| Compound Name | potassium 2-[N-ethyl-2-[(Z)-1-hydroxy-3-oxo-3-(propylamino)prop-1-enyl]-4-[[4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoyl]amino]anilino]acetate |
|---|---|
| PubChem CID | 54698683 |
| Molecular Formula | C24H26KN7O5S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | potassium 2-[N-ethyl-2-[(Z)-1-hydroxy-3-oxo-3-(propylamino)prop-1-enyl]-4-[[4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoyl]amino]anilino]acetate |
| SMILES | CCCNC(=O)/C=C(\O)c1cc(NC(=O)c2ccc(-n3[nH]nnc3=S)cc2)ccc1N(CC)CC(=O)[O-].[K+] |
| InChI | InChI=1S/C24H27N7O5S.K/c1-3-11-25-21(33)13-20(32)18-12-16(7-10-19(18)30(4-2)14-22(34)35)26-23(36)15-5-8-17(9-6-15)31-24(37)27-28-29-31;/h5-10,12-13,32H,3-4,11,14H2,1-2H3,(H,25,33)(H,26,36)(H,34,35)(H,27,29,37);/q;+1/p-1/b20-13-; |
| InChIKey | RHTZWKBDRCBYIR-MASIZSFYSA-M |
| XLogP | -1.42 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|