C32H36N4O8 — CID 54699279
N-[[3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]methyl]pyridine-3-carboxamide (PubChem CID 54699279) has the molecular formula C32H36N4O8 and a molecular weight of 604.66 g/mol. Its IUPAC name is N-[[3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54699279 |
| Molecular Formula | C32H36N4O8 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | N-[[3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]methyl]pyridine-3-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(C(C)(C)C)cc(CNC(=O)c5cccnc5)c4CC3CC12 |
| InChI | InChI=1S/C32H36N4O8/c1-31(2,3)19-11-16(13-35-30(43)14-7-6-8-34-12-14)17-9-15-10-18-23(36(4)5)26(39)22(29(33)42)28(41)32(18,44)27(40)20(15)25(38)21(17)24(19)37/h6-8,11-12,15,18,23,37-38,41,44H,9-10,13H2,1-5H3,(H2,33,42)(H,35,43) |
| InChIKey | CMIAJBDAPNESNT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 203.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|