C26H19NO3 — CID 54702960
4-[4-(4-hydroxy-2-oxochromen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile (PubChem CID 54702960) has the molecular formula C26H19NO3 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[4-(4-hydroxy-2-oxochromen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile.
| Compound Name | 4-[4-(4-hydroxy-2-oxochromen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 54702960 |
| Molecular Formula | C26H19NO3 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-[4-(4-hydroxy-2-oxochromen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2Cc3ccccc3C(c3c(O)c4ccccc4oc3=O)C2)cc1 |
| InChI | InChI=1S/C26H19NO3/c27-15-16-9-11-17(12-10-16)19-13-18-5-1-2-6-20(18)22(14-19)24-25(28)21-7-3-4-8-23(21)30-26(24)29/h1-12,19,22,28H,13-14H2 |
| InChIKey | NQYHADONJJIJJA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|