C31H23BrO3 — CID 57186316
3-[(2S)-1-[4-(4-bromophenyl)phenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-hydroxychromen-2-one (PubChem CID 57186316) has the molecular formula C31H23BrO3 and a molecular weight of 523.43 g/mol. Its IUPAC name is 3-[(2S)-1-[4-(4-bromophenyl)phenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(2S)-1-[4-(4-bromophenyl)phenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 57186316 |
| Molecular Formula | C31H23BrO3 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 3-[(2S)-1-[4-(4-bromophenyl)phenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1[C@H]1CCc2ccccc2C1c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C31H23BrO3/c32-23-16-13-20(14-17-23)19-9-11-22(12-10-19)28-24-6-2-1-5-21(24)15-18-26(28)29-30(33)25-7-3-4-8-27(25)35-31(29)34/h1-14,16-17,26,28,33H,15,18H2/t26-,28?/m0/s1 |
| InChIKey | GZUXXDQWDVPDRN-QODXOHEASA-N |
| XLogP | 7.79 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|