C30H42O2 — CID 5470604
(4E,15Z)-triaconta-4,15-dien-1,12,18,29-tetrayne-3,28-diol (PubChem CID 5470604) has the molecular formula C30H42O2 and a molecular weight of 434.66 g/mol. Its IUPAC name is (4E,15Z)-triaconta-4,15-dien-1,12,18,29-tetrayne-3,28-diol.
| Compound Name | (4E,15Z)-triaconta-4,15-dien-1,12,18,29-tetrayne-3,28-diol |
|---|---|
| PubChem CID | 5470604 |
| Molecular Formula | C30H42O2 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (4E,15Z)-triaconta-4,15-dien-1,12,18,29-tetrayne-3,28-diol |
| SMILES | C#CC(O)/C=C/CCCCCCC#CC/C=C\CC#CCCCCCCCCC(O)C#C |
| InChI | InChI=1S/C30H42O2/c1-3-29(31)27-25-23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26-28-30(32)4-2/h1-2,5-6,25,27,29-32H,7-8,13-24,26,28H2/b6-5-,27-25+ |
| InChIKey | JXQKKFJMXWVGJQ-VBPYNGQDSA-N |
| XLogP | 6.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|