C15H17NO5 — CID 54706217
ethyl 4-hydroxy-2-methoxy-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate (PubChem CID 54706217) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-methoxy-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-methoxy-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54706217 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl 4-hydroxy-2-methoxy-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(C)C1(OC)c1ccccc1 |
| InChI | InChI=1S/C15H17NO5/c1-4-21-14(19)11-12(17)13(18)16(2)15(11,20-3)10-8-6-5-7-9-10/h5-9,17H,4H2,1-3H3 |
| InChIKey | FFQBDQNVJOVWKF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |